Nafertisite, Na3Fe2+10Ti2(Si6O17)2O2(OH)6F(H2O)2, from Mt. Kukisvumchorr, Khibiny alkaline massif, Kola peninsula, Russia: Refinement of the crystal structure and revision of the chemical formula
| Image |  |
|---|---|
| Description | article |
| Author/s |
author: Yassir A. Abdu Fernando Cámara Frank C. Hawthorne Elena V. Sokolova |
| Publication date | October 1, 2014 |
| Language | |
| Country of origin | |
| Wikipedia link | |
| Copyright status | |
| Missing/wrong data? | Edit Wikidata item |