From structure topology to chemical composition. XX. Titanium silicates: the crystal structure of hejtmanite, Ba2Mn4Ti2(Si2O7)2O2(OH)2F2, a Group-II TS-block mineral
| Image |  |
|---|---|
| Description | article |
| Author/s |
author: Fernando Cámara Frank C. Hawthorne Leonid A. Pautov Elena V. Sokolova |
| Publication date | August 2016 |
| Language | |
| Country of origin | |
| Wikipedia link | |
| Copyright status | |
| Missing/wrong data? | Edit Wikidata item |