From structure topology to chemical composition. XXIII. Revision of the crystal structure and chemical formula of zvyaginite, Na2ZnTiNb2(Si2O7)2O2(OH)2(H2O)4, a seidozerite-supergroup mineral from the Lovozero alkaline massif, Kola peninsula, Russia
| Image |  |
|---|---|
| Description | article |
| Author/s |
author: Fernando Cámara Frank C. Hawthorne Elena V. Sokolova Alessandro Genovese |
| Publication date | December 2017 |
| Language | |
| Country of origin | |
| Wikipedia link | |
| Copyright status | |
| Missing/wrong data? | Edit Wikidata item |