Evidence of CO(2) molecule acting as an electron acceptor on a nanoporous metal-organic-framework MIL-53 or Cr(3+)(OH)(O(2)C-C(6)H(4)-CO(2)).
| Image |  |
|---|---|
| Description | scientific article published on 8 June 2007 |
| Author/s |
author: Christian Serre Philip L Llewellyn Arnaud Travert Alexandre Vimont Marco Daturi Gérard Férey |
| Publication date | June 8, 2007 |
| Language | English |
| Country of origin | |
| Wikipedia link | |
| Copyright status | |
| Missing/wrong data? | Edit Wikidata item |